![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1.Report of GEQAF Piloting (1).docx | 2025-06-24 09:58 | 41K | |
| 2. Report of GEQAF Piloting-India.doc | 2025-06-24 09:58 | 91K | |
| 3. Synthesis Report on tools.doc | 2025-06-24 09:58 | 55K | |
| 4.GEQAF in MP and Meghalaya.docx | 2025-06-24 09:58 | 41K | |
| Future Plan-GEQAF (1).pptx | 2025-06-24 09:58 | 10M | |
| GEQAFHINDI.pdf | 2025-06-24 09:58 | 1.1M | |
| GEQAF Pilotin in MP and Meghalaya.ppt | 2025-06-24 09:58 | 8.7M | |
| tools/ | 2025-06-24 16:00 | - | |